C11H10BrClO2 — CID 102653924
(4-bromo-3-chlorophenyl)-(2,3-dihydrofuran-5-yl)methanol (PubChem CID 102653924) has the molecular formula C11H10BrClO2 and a molecular weight of 289.56 g/mol. Its IUPAC name is (4-bromo-3-chlorophenyl)-(2,3-dihydrofuran-5-yl)methanol.
| Compound Name | (4-bromo-3-chlorophenyl)-(2,3-dihydrofuran-5-yl)methanol |
|---|---|
| PubChem CID | 102653924 |
| Molecular Formula | C11H10BrClO2 |
| Molecular Weight | 289.56 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | (4-bromo-3-chlorophenyl)-(2,3-dihydrofuran-5-yl)methanol |
| SMILES | OC(C1=CCCO1)c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C11H10BrClO2/c12-8-4-3-7(6-9(8)13)11(14)10-2-1-5-15-10/h2-4,6,11,14H,1,5H2 |
| InChIKey | UVMMPBJDSLDUGB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |