C11H12O2 — CID 102650514
2,3-dihydrofuran-5-yl(phenyl)methanol (PubChem CID 102650514) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is 2,3-dihydrofuran-5-yl(phenyl)methanol.
| Compound Name | 2,3-dihydrofuran-5-yl(phenyl)methanol |
|---|---|
| PubChem CID | 102650514 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 2,3-dihydrofuran-5-yl(phenyl)methanol |
| SMILES | OC(C1=CCCO1)c1ccccc1 |
| InChI | InChI=1S/C11H12O2/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9/h1-3,5-7,11-12H,4,8H2 |
| InChIKey | UKIABCYWZLITJH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |