C14H13NO2 — CID 102650573
2,3-dihydrofuran-5-yl(quinolin-4-yl)methanol (PubChem CID 102650573) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 2,3-dihydrofuran-5-yl(quinolin-4-yl)methanol.
| Compound Name | 2,3-dihydrofuran-5-yl(quinolin-4-yl)methanol |
|---|---|
| PubChem CID | 102650573 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2,3-dihydrofuran-5-yl(quinolin-4-yl)methanol |
| SMILES | OC(C1=CCCO1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C14H13NO2/c16-14(13-6-3-9-17-13)11-7-8-15-12-5-2-1-4-10(11)12/h1-2,4-8,14,16H,3,9H2 |
| InChIKey | OWBCPAYSNWXNFO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |