C13H16O2 — CID 102650763
2,3-dihydrofuran-5-yl-(2,6-dimethylphenyl)methanol (PubChem CID 102650763) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2,3-dihydrofuran-5-yl-(2,6-dimethylphenyl)methanol.
| Compound Name | 2,3-dihydrofuran-5-yl-(2,6-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 102650763 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2,3-dihydrofuran-5-yl-(2,6-dimethylphenyl)methanol |
| SMILES | Cc1cccc(C)c1C(O)C1=CCCO1 |
| InChI | InChI=1S/C13H16O2/c1-9-5-3-6-10(2)12(9)13(14)11-7-4-8-15-11/h3,5-7,13-14H,4,8H2,1-2H3 |
| InChIKey | ITUPDYYOZQEIHG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |