C13H16O2 — CID 102653915
1-(2,3-dihydrofuran-5-yl)-2-(3-methylphenyl)ethanol (PubChem CID 102653915) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-5-yl)-2-(3-methylphenyl)ethanol.
| Compound Name | 1-(2,3-dihydrofuran-5-yl)-2-(3-methylphenyl)ethanol |
|---|---|
| PubChem CID | 102653915 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 1-(2,3-dihydrofuran-5-yl)-2-(3-methylphenyl)ethanol |
| SMILES | Cc1cccc(CC(O)C2=CCCO2)c1 |
| InChI | InChI=1S/C13H16O2/c1-10-4-2-5-11(8-10)9-12(14)13-6-3-7-15-13/h2,4-6,8,12,14H,3,7,9H2,1H3 |
| InChIKey | HFKGYRYYSXMNBW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |