C12H13FO2 — CID 102653978
1-(2,3-dihydrofuran-5-yl)-2-(2-fluorophenyl)ethanol (PubChem CID 102653978) has the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-5-yl)-2-(2-fluorophenyl)ethanol.
| Compound Name | 1-(2,3-dihydrofuran-5-yl)-2-(2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 102653978 |
| Molecular Formula | C12H13FO2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 1-(2,3-dihydrofuran-5-yl)-2-(2-fluorophenyl)ethanol |
| SMILES | OC(Cc1ccccc1F)C1=CCCO1 |
| InChI | InChI=1S/C12H13FO2/c13-10-5-2-1-4-9(10)8-11(14)12-6-3-7-15-12/h1-2,4-6,11,14H,3,7-8H2 |
| InChIKey | UYLUPGQARQSMTP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |