C17H17FO2 — CID 114744473
1-(3,4-dihydro-2H-chromen-8-yl)-2-(2-fluorophenyl)ethanol (PubChem CID 114744473) has the molecular formula C17H17FO2 and a molecular weight of 272.32 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-8-yl)-2-(2-fluorophenyl)ethanol.
| Compound Name | 1-(3,4-dihydro-2H-chromen-8-yl)-2-(2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 114744473 |
| Molecular Formula | C17H17FO2 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-8-yl)-2-(2-fluorophenyl)ethanol |
| SMILES | OC(Cc1ccccc1F)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C17H17FO2/c18-15-9-2-1-5-13(15)11-16(19)14-8-3-6-12-7-4-10-20-17(12)14/h1-3,5-6,8-9,16,19H,4,7,10-11H2 |
| InChIKey | HGYXYRANHTUAFY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |