C17H17ClO2S — CID 114744615
2-(4-chlorophenyl)sulfanyl-1-(3,4-dihydro-2H-chromen-8-yl)ethanol (PubChem CID 114744615) has the molecular formula C17H17ClO2S and a molecular weight of 320.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-1-(3,4-dihydro-2H-chromen-8-yl)ethanol.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-1-(3,4-dihydro-2H-chromen-8-yl)ethanol |
|---|---|
| PubChem CID | 114744615 |
| Molecular Formula | C17H17ClO2S |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-1-(3,4-dihydro-2H-chromen-8-yl)ethanol |
| SMILES | OC(CSc1ccc(Cl)cc1)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C17H17ClO2S/c18-13-6-8-14(9-7-13)21-11-16(19)15-5-1-3-12-4-2-10-20-17(12)15/h1,3,5-9,16,19H,2,4,10-11H2 |
| InChIKey | ZDOULSYHBLYUDI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |