C16H14BrClO2 — CID 107947846
(3-bromo-5-chlorophenyl)-(3,4-dihydro-2H-chromen-8-yl)methanol (PubChem CID 107947846) has the molecular formula C16H14BrClO2 and a molecular weight of 353.64 g/mol. Its IUPAC name is (3-bromo-5-chlorophenyl)-(3,4-dihydro-2H-chromen-8-yl)methanol.
| Compound Name | (3-bromo-5-chlorophenyl)-(3,4-dihydro-2H-chromen-8-yl)methanol |
|---|---|
| PubChem CID | 107947846 |
| Molecular Formula | C16H14BrClO2 |
| Molecular Weight | 353.64 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | (3-bromo-5-chlorophenyl)-(3,4-dihydro-2H-chromen-8-yl)methanol |
| SMILES | OC(c1cc(Cl)cc(Br)c1)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C16H14BrClO2/c17-12-7-11(8-13(18)9-12)15(19)14-5-1-3-10-4-2-6-20-16(10)14/h1,3,5,7-9,15,19H,2,4,6H2 |
| InChIKey | UTFZCBUJERLOAV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.64 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |