C16H16BrClN2O — CID 107948543
[(3-bromo-5-chlorophenyl)-(3,4-dihydro-2H-chromen-8-yl)methyl]hydrazine (PubChem CID 107948543) has the molecular formula C16H16BrClN2O and a molecular weight of 367.67 g/mol. Its IUPAC name is [(3-bromo-5-chlorophenyl)-(3,4-dihydro-2H-chromen-8-yl)methyl]hydrazine.
| Compound Name | [(3-bromo-5-chlorophenyl)-(3,4-dihydro-2H-chromen-8-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107948543 |
| Molecular Formula | C16H16BrClN2O |
| Molecular Weight | 367.67 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | [(3-bromo-5-chlorophenyl)-(3,4-dihydro-2H-chromen-8-yl)methyl]hydrazine |
| SMILES | NNC(c1cc(Cl)cc(Br)c1)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C16H16BrClN2O/c17-12-7-11(8-13(18)9-12)15(20-19)14-5-1-3-10-4-2-6-21-16(10)14/h1,3,5,7-9,15,20H,2,4,6,19H2 |
| InChIKey | LMUPBIUZCCYZDH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.67 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|