C15H16O2S — CID 105130684
1-(3,4-dihydro-2H-chromen-8-yl)-2-thiophen-3-ylethanol (PubChem CID 105130684) has the molecular formula C15H16O2S and a molecular weight of 260.36 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-8-yl)-2-thiophen-3-ylethanol.
| Compound Name | 1-(3,4-dihydro-2H-chromen-8-yl)-2-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 105130684 |
| Molecular Formula | C15H16O2S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-8-yl)-2-thiophen-3-ylethanol |
| SMILES | OC(Cc1ccsc1)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C15H16O2S/c16-14(9-11-6-8-18-10-11)13-5-1-3-12-4-2-7-17-15(12)13/h1,3,5-6,8,10,14,16H,2,4,7,9H2 |
| InChIKey | RJLRYWWIVMIPCD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |