C16H22O3 — CID 114744756
1-(3,4-dihydro-2H-chromen-8-yl)-2-(oxan-2-yl)ethanol (PubChem CID 114744756) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-8-yl)-2-(oxan-2-yl)ethanol.
| Compound Name | 1-(3,4-dihydro-2H-chromen-8-yl)-2-(oxan-2-yl)ethanol |
|---|---|
| PubChem CID | 114744756 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-8-yl)-2-(oxan-2-yl)ethanol |
| SMILES | OC(CC1CCCCO1)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C16H22O3/c17-15(11-13-7-1-2-9-18-13)14-8-3-5-12-6-4-10-19-16(12)14/h3,5,8,13,15,17H,1-2,4,6-7,9-11H2 |
| InChIKey | IKGNWCNALKVALG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |