C14H21NO3 — CID 114747435
1-(3,4-dihydro-2H-chromen-8-yl)-2-(2-methoxyethylamino)ethanol (PubChem CID 114747435) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-8-yl)-2-(2-methoxyethylamino)ethanol.
| Compound Name | 1-(3,4-dihydro-2H-chromen-8-yl)-2-(2-methoxyethylamino)ethanol |
|---|---|
| PubChem CID | 114747435 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-8-yl)-2-(2-methoxyethylamino)ethanol |
| SMILES | COCCNCC(O)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C14H21NO3/c1-17-9-7-15-10-13(16)12-6-2-4-11-5-3-8-18-14(11)12/h2,4,6,13,15-16H,3,5,7-10H2,1H3 |
| InChIKey | NJJZCFXLLJRWJC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|