C14H21NO2 — CID 114745442
1-(3,4-dihydro-2H-chromen-8-yl)-4-methoxybutan-1-amine (PubChem CID 114745442) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-8-yl)-4-methoxybutan-1-amine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-8-yl)-4-methoxybutan-1-amine |
|---|---|
| PubChem CID | 114745442 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-8-yl)-4-methoxybutan-1-amine |
| SMILES | COCCCC(N)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C14H21NO2/c1-16-9-4-8-13(15)12-7-2-5-11-6-3-10-17-14(11)12/h2,5,7,13H,3-4,6,8-10,15H2,1H3 |
| InChIKey | JNFLLGMKWLGGRT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|