C11H10F2O2 — CID 102650584
(2,3-difluorophenyl)-(2,3-dihydrofuran-5-yl)methanol (PubChem CID 102650584) has the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. Its IUPAC name is (2,3-difluorophenyl)-(2,3-dihydrofuran-5-yl)methanol.
| Compound Name | (2,3-difluorophenyl)-(2,3-dihydrofuran-5-yl)methanol |
|---|---|
| PubChem CID | 102650584 |
| Molecular Formula | C11H10F2O2 |
| Molecular Weight | 212.19 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | (2,3-difluorophenyl)-(2,3-dihydrofuran-5-yl)methanol |
| SMILES | OC(C1=CCCO1)c1cccc(F)c1F |
| InChI | InChI=1S/C11H10F2O2/c12-8-4-1-3-7(10(8)13)11(14)9-5-2-6-15-9/h1,3-5,11,14H,2,6H2 |
| InChIKey | MFRUFMOQPHIGHK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.19 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |