C17H16O2 — CID 102650545
2,3-dihydrofuran-5-yl-(4-phenylphenyl)methanol (PubChem CID 102650545) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2,3-dihydrofuran-5-yl-(4-phenylphenyl)methanol.
| Compound Name | 2,3-dihydrofuran-5-yl-(4-phenylphenyl)methanol |
|---|---|
| PubChem CID | 102650545 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2,3-dihydrofuran-5-yl-(4-phenylphenyl)methanol |
| SMILES | OC(C1=CCCO1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H16O2/c18-17(16-7-4-12-19-16)15-10-8-14(9-11-15)13-5-2-1-3-6-13/h1-3,5-11,17-18H,4,12H2 |
| InChIKey | VGNHOBAURAIUGW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |