C13H13NO2 — CID 114985464
4-[3,4-dihydro-2H-pyran-6-yl(hydroxy)methyl]benzonitrile (PubChem CID 114985464) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 4-[3,4-dihydro-2H-pyran-6-yl(hydroxy)methyl]benzonitrile.
| Compound Name | 4-[3,4-dihydro-2H-pyran-6-yl(hydroxy)methyl]benzonitrile |
|---|---|
| PubChem CID | 114985464 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 4-[3,4-dihydro-2H-pyran-6-yl(hydroxy)methyl]benzonitrile |
| SMILES | N#Cc1ccc(C(O)C2=CCCCO2)cc1 |
| InChI | InChI=1S/C13H13NO2/c14-9-10-4-6-11(7-5-10)13(15)12-3-1-2-8-16-12/h3-7,13,15H,1-2,8H2 |
| InChIKey | OSGAJOVAIPANAJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |