C10H18O3 — CID 103456632
1-(3,4-dihydro-2H-pyran-6-yl)-3-methylbutane-1,2-diol (PubChem CID 103456632) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)-3-methylbutane-1,2-diol.
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)-3-methylbutane-1,2-diol |
|---|---|
| PubChem CID | 103456632 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)-3-methylbutane-1,2-diol |
| SMILES | CC(C)C(O)C(O)C1=CCCCO1 |
| InChI | InChI=1S/C10H18O3/c1-7(2)9(11)10(12)8-5-3-4-6-13-8/h5,7,9-12H,3-4,6H2,1-2H3 |
| InChIKey | YWHWTUVBYNTZIF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |