C17H24O2 — CID 102649655
1-(3,4-dihydro-2H-pyran-6-yl)-3-methyl-2-phenylpentan-1-ol (PubChem CID 102649655) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)-3-methyl-2-phenylpentan-1-ol.
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)-3-methyl-2-phenylpentan-1-ol |
|---|---|
| PubChem CID | 102649655 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)-3-methyl-2-phenylpentan-1-ol |
| SMILES | CCC(C)C(c1ccccc1)C(O)C1=CCCCO1 |
| InChI | InChI=1S/C17H24O2/c1-3-13(2)16(14-9-5-4-6-10-14)17(18)15-11-7-8-12-19-15/h4-6,9-11,13,16-18H,3,7-8,12H2,1-2H3 |
| InChIKey | ZIOVXMHJJJKCLJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |