C14H17ClO3 — CID 102649827
2-(3-chlorophenoxy)-1-(3,4-dihydro-2H-pyran-6-yl)propan-1-ol (PubChem CID 102649827) has the molecular formula C14H17ClO3 and a molecular weight of 268.74 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-1-(3,4-dihydro-2H-pyran-6-yl)propan-1-ol.
| Compound Name | 2-(3-chlorophenoxy)-1-(3,4-dihydro-2H-pyran-6-yl)propan-1-ol |
|---|---|
| PubChem CID | 102649827 |
| Molecular Formula | C14H17ClO3 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-(3-chlorophenoxy)-1-(3,4-dihydro-2H-pyran-6-yl)propan-1-ol |
| SMILES | CC(Oc1cccc(Cl)c1)C(O)C1=CCCCO1 |
| InChI | InChI=1S/C14H17ClO3/c1-10(14(16)13-7-2-3-8-17-13)18-12-6-4-5-11(15)9-12/h4-7,9-10,14,16H,2-3,8H2,1H3 |
| InChIKey | YVHMKCQAFUQZLX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |