C18H21ClO2 — CID 105103501
2-(3-chlorophenoxy)-1-(2,4,5-trimethylphenyl)propan-1-ol (PubChem CID 105103501) has the molecular formula C18H21ClO2 and a molecular weight of 304.82 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-1-(2,4,5-trimethylphenyl)propan-1-ol.
| Compound Name | 2-(3-chlorophenoxy)-1-(2,4,5-trimethylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 105103501 |
| Molecular Formula | C18H21ClO2 |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-(3-chlorophenoxy)-1-(2,4,5-trimethylphenyl)propan-1-ol |
| SMILES | Cc1cc(C)c(C(O)C(C)Oc2cccc(Cl)c2)cc1C |
| InChI | InChI=1S/C18H21ClO2/c1-11-8-13(3)17(9-12(11)2)18(20)14(4)21-16-7-5-6-15(19)10-16/h5-10,14,18,20H,1-4H3 |
| InChIKey | XNLCMCLEVHNYQX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |