C10H10ClNO2 — CID 102654800
(6-chloro-3-pyridinyl)-(2,3-dihydrofuran-5-yl)methanol (PubChem CID 102654800) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)-(2,3-dihydrofuran-5-yl)methanol.
| Compound Name | (6-chloro-3-pyridinyl)-(2,3-dihydrofuran-5-yl)methanol |
|---|---|
| PubChem CID | 102654800 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | (6-chloro-3-pyridinyl)-(2,3-dihydrofuran-5-yl)methanol |
| SMILES | OC(C1=CCCO1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H10ClNO2/c11-9-4-3-7(6-12-9)10(13)8-2-1-5-14-8/h2-4,6,10,13H,1,5H2 |
| InChIKey | YPWKDSJUBQHEFC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|