C9H5Br3O2S — CID 115800624
(3-bromofuran-2-yl)-(4,5-dibromothiophen-2-yl)methanol (PubChem CID 115800624) has the molecular formula C9H5Br3O2S and a molecular weight of 416.92 g/mol. Its IUPAC name is (3-bromofuran-2-yl)-(4,5-dibromothiophen-2-yl)methanol.
| Compound Name | (3-bromofuran-2-yl)-(4,5-dibromothiophen-2-yl)methanol |
|---|---|
| PubChem CID | 115800624 |
| Molecular Formula | C9H5Br3O2S |
| Molecular Weight | 416.92 g/mol |
| Exact Mass | 413.76 |
| IUPAC Name | (3-bromofuran-2-yl)-(4,5-dibromothiophen-2-yl)methanol |
| SMILES | OC(c1cc(Br)c(Br)s1)c1occc1Br |
| InChI | InChI=1S/C9H5Br3O2S/c10-4-1-2-14-8(4)7(13)6-3-5(11)9(12)15-6/h1-3,7,13H |
| InChIKey | QKJPIAOAJXJDMI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.92 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |