C14H12Br2O4S — CID 126515394
(2E)-3-bromo-1-[5-[(3-bromofuran-2-yl)-hydroxymethyl]thiophen-2-yl]penta-2,4-diene-1,2-diol (PubChem CID 126515394) has the molecular formula C14H12Br2O4S and a molecular weight of 436.12 g/mol. Its IUPAC name is (2E)-3-bromo-1-[5-[(3-bromofuran-2-yl)-hydroxymethyl]thiophen-2-yl]penta-2,4-diene-1,2-diol.
| Compound Name | (2E)-3-bromo-1-[5-[(3-bromofuran-2-yl)-hydroxymethyl]thiophen-2-yl]penta-2,4-diene-1,2-diol |
|---|---|
| PubChem CID | 126515394 |
| Molecular Formula | C14H12Br2O4S |
| Molecular Weight | 436.12 g/mol |
| Exact Mass | 433.88 |
| IUPAC Name | (2E)-3-bromo-1-[5-[(3-bromofuran-2-yl)-hydroxymethyl]thiophen-2-yl]penta-2,4-diene-1,2-diol |
| SMILES | C=C/C(Br)=C(\O)C(O)c1ccc(C(O)c2occc2Br)s1 |
| InChI | InChI=1S/C14H12Br2O4S/c1-2-7(15)11(17)12(18)9-3-4-10(21-9)13(19)14-8(16)5-6-20-14/h2-6,12-13,17-19H,1H2/b11-7+ |
| InChIKey | MNYBXCIPSBEGFB-YRNVUSSQSA-N |
| XLogP | 4.57 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.12 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|