C10H7BrO4S — CID 107432083
2-[(5-bromothiophen-2-yl)-hydroxymethyl]furan-3-carboxylic acid (PubChem CID 107432083) has the molecular formula C10H7BrO4S and a molecular weight of 303.13 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)-hydroxymethyl]furan-3-carboxylic acid.
| Compound Name | 2-[(5-bromothiophen-2-yl)-hydroxymethyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 107432083 |
| Molecular Formula | C10H7BrO4S |
| Molecular Weight | 303.13 g/mol |
| Exact Mass | 301.92 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)-hydroxymethyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1ccoc1C(O)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H7BrO4S/c11-7-2-1-6(16-7)8(12)9-5(10(13)14)3-4-15-9/h1-4,8,12H,(H,13,14) |
| InChIKey | LJKDVSKWZRJOAL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.13 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |