C10H10N2O4 — CID 107432373
2-[hydroxy-(3-methylimidazol-4-yl)methyl]furan-3-carboxylic acid (PubChem CID 107432373) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is 2-[hydroxy-(3-methylimidazol-4-yl)methyl]furan-3-carboxylic acid.
| Compound Name | 2-[hydroxy-(3-methylimidazol-4-yl)methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 107432373 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-[hydroxy-(3-methylimidazol-4-yl)methyl]furan-3-carboxylic acid |
| SMILES | Cn1cncc1C(O)c1occc1C(=O)O |
| InChI | InChI=1S/C10H10N2O4/c1-12-5-11-4-7(12)8(13)9-6(10(14)15)2-3-16-9/h2-5,8,13H,1H3,(H,14,15) |
| InChIKey | IUXHYQPREMQJBR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |