C29H32OSi — CID 23631659
tert-butyl-[(R)-[(1S)-cyclohexa-2,4-dien-1-yl]-phenylmethoxy]-diphenylsilane (PubChem CID 23631659) has the molecular formula C29H32OSi and a molecular weight of 424.66 g/mol. Its IUPAC name is tert-butyl-[(R)-[(1S)-cyclohexa-2,4-dien-1-yl]-phenylmethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(R)-[(1S)-cyclohexa-2,4-dien-1-yl]-phenylmethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 23631659 |
| Molecular Formula | C29H32OSi |
| Molecular Weight | 424.66 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | tert-butyl-[(R)-[(1S)-cyclohexa-2,4-dien-1-yl]-phenylmethoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](O[C@@H](c1ccccc1)[C@@H]1C=CC=CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H32OSi/c1-29(2,3)31(26-20-12-6-13-21-26,27-22-14-7-15-23-27)30-28(24-16-8-4-9-17-24)25-18-10-5-11-19-25/h4-18,20-23,25,28H,19H2,1-3H3/t25-,28+/m1/s1 |
| InChIKey | BTCODLHPFIZNID-NAKRPHOHSA-N |
| XLogP | 6.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.66 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|