C24H32OSi — CID 57379185
tert-butyl-[(1S)-1-[(1S)-cyclohex-2-en-1-yl]ethoxy]-diphenylsilane (PubChem CID 57379185) has the molecular formula C24H32OSi and a molecular weight of 364.61 g/mol. Its IUPAC name is tert-butyl-[(1S)-1-[(1S)-cyclohex-2-en-1-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(1S)-1-[(1S)-cyclohex-2-en-1-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 57379185 |
| Molecular Formula | C24H32OSi |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | tert-butyl-[(1S)-1-[(1S)-cyclohex-2-en-1-yl]ethoxy]-diphenylsilane |
| SMILES | C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1C=CCCC1 |
| InChI | InChI=1S/C24H32OSi/c1-20(21-14-8-5-9-15-21)25-26(24(2,3)4,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h6-8,10-14,16-21H,5,9,15H2,1-4H3/t20-,21+/m0/s1 |
| InChIKey | XLACHAXJCWSPML-LEWJYISDSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|