C22H26Cl2O2Si — CID 66739441
3-[1-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dichlorocyclobutan-1-one (PubChem CID 66739441) has the molecular formula C22H26Cl2O2Si and a molecular weight of 421.44 g/mol. Its IUPAC name is 3-[1-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dichlorocyclobutan-1-one.
| Compound Name | 3-[1-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dichlorocyclobutan-1-one |
|---|---|
| PubChem CID | 66739441 |
| Molecular Formula | C22H26Cl2O2Si |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 3-[1-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dichlorocyclobutan-1-one |
| SMILES | CC(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C1CC(=O)C1(Cl)Cl |
| InChI | InChI=1S/C22H26Cl2O2Si/c1-16(19-15-20(25)22(19,23)24)26-27(21(2,3)4,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,16,19H,15H2,1-4H3 |
| InChIKey | GIIHQZKZUYCSIL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|