C23H28Cl2O3Si — CID 134874257
(4R)-4-[(1S)-1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-3,3-dichlorooxetan-2-one (PubChem CID 134874257) has the molecular formula C23H28Cl2O3Si and a molecular weight of 451.47 g/mol. Its IUPAC name is (4R)-4-[(1S)-1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-3,3-dichlorooxetan-2-one.
| Compound Name | (4R)-4-[(1S)-1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-3,3-dichlorooxetan-2-one |
|---|---|
| PubChem CID | 134874257 |
| Molecular Formula | C23H28Cl2O3Si |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | (4R)-4-[(1S)-1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropyl]-3,3-dichlorooxetan-2-one |
| SMILES | CC(C)[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1OC(=O)C1(Cl)Cl |
| InChI | InChI=1S/C23H28Cl2O3Si/c1-16(2)19(20-23(24,25)21(26)27-20)28-29(22(3,4)5,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-16,19-20H,1-5H3/t19-,20+/m0/s1 |
| InChIKey | QEKZPUCPAJIFSO-VQTJNVASSA-N |
| XLogP | 4.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|