C22H27BrO3Si — CID 100999050
(5S)-5-[(1R)-2-bromo-1-[tert-butyl(diphenyl)silyl]oxyethyl]oxolan-2-one (PubChem CID 100999050) has the molecular formula C22H27BrO3Si and a molecular weight of 447.45 g/mol. Its IUPAC name is (5S)-5-[(1R)-2-bromo-1-[tert-butyl(diphenyl)silyl]oxyethyl]oxolan-2-one.
| Compound Name | (5S)-5-[(1R)-2-bromo-1-[tert-butyl(diphenyl)silyl]oxyethyl]oxolan-2-one |
|---|---|
| PubChem CID | 100999050 |
| Molecular Formula | C22H27BrO3Si |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | (5S)-5-[(1R)-2-bromo-1-[tert-butyl(diphenyl)silyl]oxyethyl]oxolan-2-one |
| SMILES | CC(C)(C)[Si](O[C@@H](CBr)[C@@H]1CCC(=O)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27BrO3Si/c1-22(2,3)27(17-10-6-4-7-11-17,18-12-8-5-9-13-18)26-20(16-23)19-14-15-21(24)25-19/h4-13,19-20H,14-16H2,1-3H3/t19-,20-/m0/s1 |
| InChIKey | FRTPKCBDHFXWLG-PMACEKPBSA-N |
| XLogP | 4.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|