C27H38O3Si — CID 46844682
(4R,6R)-6-[(2R)-2-[tert-butyl(diphenyl)silyl]oxypentyl]-4-methyloxan-2-one (PubChem CID 46844682) has the molecular formula C27H38O3Si and a molecular weight of 438.68 g/mol. Its IUPAC name is (4R,6R)-6-[(2R)-2-[tert-butyl(diphenyl)silyl]oxypentyl]-4-methyloxan-2-one.
| Compound Name | (4R,6R)-6-[(2R)-2-[tert-butyl(diphenyl)silyl]oxypentyl]-4-methyloxan-2-one |
|---|---|
| PubChem CID | 46844682 |
| Molecular Formula | C27H38O3Si |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | (4R,6R)-6-[(2R)-2-[tert-butyl(diphenyl)silyl]oxypentyl]-4-methyloxan-2-one |
| SMILES | CCC[C@H](C[C@H]1C[C@@H](C)CC(=O)O1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H38O3Si/c1-6-13-22(20-23-18-21(2)19-26(28)29-23)30-31(27(3,4)5,24-14-9-7-10-15-24)25-16-11-8-12-17-25/h7-12,14-17,21-23H,6,13,18-20H2,1-5H3/t21-,22-,23-/m1/s1 |
| InChIKey | NSDQAWOXVCLYFR-DNVJHFABSA-N |
| XLogP | 5.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|