C55H76O4Si2 — CID 67605197
(3Z)-5-[bis[[tert-butyl(diphenyl)silyl]oxy]methyl]-3-octadec-9-enylideneoxolan-2-one (PubChem CID 67605197) has the molecular formula C55H76O4Si2 and a molecular weight of 857.38 g/mol. Its IUPAC name is (3Z)-5-[bis[[tert-butyl(diphenyl)silyl]oxy]methyl]-3-octadec-9-enylideneoxolan-2-one.
| Compound Name | (3Z)-5-[bis[[tert-butyl(diphenyl)silyl]oxy]methyl]-3-octadec-9-enylideneoxolan-2-one |
|---|---|
| PubChem CID | 67605197 |
| Molecular Formula | C55H76O4Si2 |
| Molecular Weight | 857.38 g/mol |
| Exact Mass | 856.53 |
| IUPAC Name | (3Z)-5-[bis[[tert-butyl(diphenyl)silyl]oxy]methyl]-3-octadec-9-enylideneoxolan-2-one |
| SMILES | CCCCCCCCC=CCCCCCCC/C=C1/CC(C(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C55H76O4Si2/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27-36-46-45-51(57-52(46)56)53(58-60(54(2,3)4,47-37-28-23-29-38-47)48-39-30-24-31-40-48)59-61(55(5,6)7,49-41-32-25-33-42-49)50-43-34-26-35-44-50/h15-16,23-26,28-44,51,53H,8-14,17-22,27,45H2,1-7H3/b16-15?,46-36- |
| InChIKey | UUUKYHZSLBUXTE-JGIXGIRLSA-N |
| XLogP | 12.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.38 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|