C15H26O2 — CID 124636115
(3Z,5R)-3-decylidene-5-methyloxolan-2-one (PubChem CID 124636115) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (3Z,5R)-3-decylidene-5-methyloxolan-2-one.
| Compound Name | (3Z,5R)-3-decylidene-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 124636115 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (3Z,5R)-3-decylidene-5-methyloxolan-2-one |
| SMILES | CCCCCCCCC/C=C1/C[C@@H](C)OC1=O |
| InChI | InChI=1S/C15H26O2/c1-3-4-5-6-7-8-9-10-11-14-12-13(2)17-15(14)16/h11,13H,3-10,12H2,1-2H3/b14-11-/t13-/m1/s1 |
| InChIKey | TUXWUKLVKDZOCT-KECPUOCWSA-N |
| XLogP | 4.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|