C24H42O5 — CID 10525642
[(1S)-2-hydroxy-1-[(2S,4Z)-4-nonylidene-5-oxooxolan-2-yl]ethyl] nonanoate (PubChem CID 10525642) has the molecular formula C24H42O5 and a molecular weight of 410.60 g/mol. Its IUPAC name is [(1S)-2-hydroxy-1-[(2S,4Z)-4-nonylidene-5-oxooxolan-2-yl]ethyl] nonanoate.
| Compound Name | [(1S)-2-hydroxy-1-[(2S,4Z)-4-nonylidene-5-oxooxolan-2-yl]ethyl] nonanoate |
|---|---|
| PubChem CID | 10525642 |
| Molecular Formula | C24H42O5 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | [(1S)-2-hydroxy-1-[(2S,4Z)-4-nonylidene-5-oxooxolan-2-yl]ethyl] nonanoate |
| SMILES | CCCCCCCC/C=C1/C[C@@H]([C@H](CO)OC(=O)CCCCCCCC)OC1=O |
| InChI | InChI=1S/C24H42O5/c1-3-5-7-9-11-12-14-16-20-18-21(29-24(20)27)22(19-25)28-23(26)17-15-13-10-8-6-4-2/h16,21-22,25H,3-15,17-19H2,1-2H3/b20-16-/t21-,22-/m0/s1 |
| InChIKey | WAXUSWRZNQYUAJ-BURFVFRZSA-N |
| XLogP | 5.63 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|