About (3Z)-3-ethylidene-5-methyloxolan-2-one;nonane
(3Z)-3-ethylidene-5-methyloxolan-2-one;nonane (PubChem CID 143453899) has the molecular formula C16H30O2
and a molecular weight of 254.41 g/mol. Its IUPAC name is (3Z)-3-ethylidene-5-methyloxolan-2-one;nonane.
Molecular Properties
| Compound Name | (3Z)-3-ethylidene-5-methyloxolan-2-one;nonane |
| PubChem CID | 143453899 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (3Z)-3-ethylidene-5-methyloxolan-2-one;nonane |
| SMILES | C/C=C1/CC(C)OC1=O.CCCCCCCCC |
| InChI | InChI=1S/C9H20.C7H10O2/c1-3-5-7-9-8-6-4-2;1-3-6-4-5(2)9-7(6)8/h3-9H2,1-2H3;3,5H,4H2,1-2H3/b;6-3- |
| InChIKey | HJSFZLYWGJCVKP-HNIPKTKKSA-N |
| XLogP | 5.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-ethylidene-5-methyloxolan-2-one;nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-ethylidene-5-methyloxolan-2-one;nonane?
The IUPAC name of (3Z)-3-ethylidene-5-methyloxolan-2-one;nonane (CID 143453899) is (3Z)-3-ethylidene-5-methyloxolan-2-one;nonane.
What is the SMILES notation for (3Z)-3-ethylidene-5-methyloxolan-2-one;nonane?
The canonical SMILES for (3Z)-3-ethylidene-5-methyloxolan-2-one;nonane is C/C=C1/CC(C)OC1=O.CCCCCCCCC.
What is the InChIKey of (3Z)-3-ethylidene-5-methyloxolan-2-one;nonane?
The InChIKey is HJSFZLYWGJCVKP-HNIPKTKKSA-N. The full InChI is InChI=1S/C9H20.C7H10O2/c1-3-5-7-9-8-6-4-2;1-3-6-4-5(2)9-7(6)8/h3-9H2,1-2H3;3,5H,4H2,1-2H3/b;6-3-.
What are the key properties of (3Z)-3-ethylidene-5-methyloxolan-2-one;nonane?
(3Z)-3-ethylidene-5-methyloxolan-2-one;nonane has a molecular weight of 254.41 g/mol, XLogP of 5.03, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-ethylidene-5-methyloxolan-2-one;nonane is sourced from PubChem (CID 143453899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).