C11H18O2 — CID 13058489
4-butyl-2,5-dimethyl-2,3-dihydropyran-6-one (PubChem CID 13058489) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 4-butyl-2,5-dimethyl-2,3-dihydropyran-6-one.
| Compound Name | 4-butyl-2,5-dimethyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 13058489 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 4-butyl-2,5-dimethyl-2,3-dihydropyran-6-one |
| SMILES | CCCCC1=C(C)C(=O)OC(C)C1 |
| InChI | InChI=1S/C11H18O2/c1-4-5-6-10-7-8(2)13-11(12)9(10)3/h8H,4-7H2,1-3H3 |
| InChIKey | TXIQZQPXZQNNPG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |