C10H14O4 — CID 131851967
(3Z)-3-(1-hydroxybutylidene)-6-methyloxane-2,4-dione (PubChem CID 131851967) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (3Z)-3-(1-hydroxybutylidene)-6-methyloxane-2,4-dione.
| Compound Name | (3Z)-3-(1-hydroxybutylidene)-6-methyloxane-2,4-dione |
|---|---|
| PubChem CID | 131851967 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (3Z)-3-(1-hydroxybutylidene)-6-methyloxane-2,4-dione |
| SMILES | CCC/C(O)=C1\C(=O)CC(C)OC1=O |
| InChI | InChI=1S/C10H14O4/c1-3-4-7(11)9-8(12)5-6(2)14-10(9)13/h6,11H,3-5H2,1-2H3/b9-7- |
| InChIKey | PMLQEYPNXGMZDZ-CLFYSBASSA-N |
| XLogP | 1.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|