C20H34O4 — CID 122407202
(3E,6R)-3-(1-hydroxydodecylidene)-6-propyloxane-2,4-dione (PubChem CID 122407202) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is (3E,6R)-3-(1-hydroxydodecylidene)-6-propyloxane-2,4-dione.
| Compound Name | (3E,6R)-3-(1-hydroxydodecylidene)-6-propyloxane-2,4-dione |
|---|---|
| PubChem CID | 122407202 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (3E,6R)-3-(1-hydroxydodecylidene)-6-propyloxane-2,4-dione |
| SMILES | CCCCCCCCCCC/C(O)=C1/C(=O)C[C@@H](CCC)OC1=O |
| InChI | InChI=1S/C20H34O4/c1-3-5-6-7-8-9-10-11-12-14-17(21)19-18(22)15-16(13-4-2)24-20(19)23/h16,21H,3-15H2,1-2H3/b19-17+/t16-/m1/s1 |
| InChIKey | GXZYAPGJXHLAQG-GWOGKKTRSA-N |
| XLogP | 5.40 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|