C18H30O4 — CID 86276225
(3Z)-3-(1-hydroxytetradecylidene)oxolane-2,4-dione (PubChem CID 86276225) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is (3Z)-3-(1-hydroxytetradecylidene)oxolane-2,4-dione.
| Compound Name | (3Z)-3-(1-hydroxytetradecylidene)oxolane-2,4-dione |
|---|---|
| PubChem CID | 86276225 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (3Z)-3-(1-hydroxytetradecylidene)oxolane-2,4-dione |
| SMILES | CCCCCCCCCCCCC/C(O)=C1\C(=O)COC1=O |
| InChI | InChI=1S/C18H30O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-15(19)17-16(20)14-22-18(17)21/h19H,2-14H2,1H3/b17-15- |
| InChIKey | JJAMPIBFAUKCQU-ICFOKQHNSA-N |
| XLogP | 4.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|