C22H36O3S — CID 135921841
(3E)-3-[(Z)-1-hydroxyoctadec-9-enylidene]thiolane-2,4-dione (PubChem CID 135921841) has the molecular formula C22H36O3S and a molecular weight of 380.59 g/mol. Its IUPAC name is (3E)-3-[(Z)-1-hydroxyoctadec-9-enylidene]thiolane-2,4-dione.
| Compound Name | (3E)-3-[(Z)-1-hydroxyoctadec-9-enylidene]thiolane-2,4-dione |
|---|---|
| PubChem CID | 135921841 |
| Molecular Formula | C22H36O3S |
| Molecular Weight | 380.59 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (3E)-3-[(Z)-1-hydroxyoctadec-9-enylidene]thiolane-2,4-dione |
| SMILES | CCCCCCCC/C=C\CCCCCCC/C(O)=C1/C(=O)CSC1=O |
| InChI | InChI=1S/C22H36O3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(23)21-20(24)18-26-22(21)25/h9-10,23H,2-8,11-18H2,1H3/b10-9-,21-19+ |
| InChIKey | SOLKINAMUGWQKF-YSBCPJPDSA-N |
| XLogP | 6.68 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.59 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|