C14H15NO4 — CID 69353225
3-[2-(4-aminophenyl)-1-hydroxyethylidene]-6-methyloxane-2,4-dione (PubChem CID 69353225) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-[2-(4-aminophenyl)-1-hydroxyethylidene]-6-methyloxane-2,4-dione.
| Compound Name | 3-[2-(4-aminophenyl)-1-hydroxyethylidene]-6-methyloxane-2,4-dione |
|---|---|
| PubChem CID | 69353225 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 3-[2-(4-aminophenyl)-1-hydroxyethylidene]-6-methyloxane-2,4-dione |
| SMILES | CC1CC(=O)C(=C(O)Cc2ccc(N)cc2)C(=O)O1 |
| InChI | InChI=1S/C14H15NO4/c1-8-6-11(16)13(14(18)19-8)12(17)7-9-2-4-10(15)5-3-9/h2-5,8,17H,6-7,15H2,1H3 |
| InChIKey | XVVKYLXRXBYSLR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|