C13H19NO5 — CID 165368397
(5E)-5-hydroxy-N,N-dimethyl-5-[(6R)-6-methyl-2,4-dioxooxan-3-ylidene]pentanamide (PubChem CID 165368397) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is (5E)-5-hydroxy-N,N-dimethyl-5-[(6R)-6-methyl-2,4-dioxooxan-3-ylidene]pentanamide.
| Compound Name | (5E)-5-hydroxy-N,N-dimethyl-5-[(6R)-6-methyl-2,4-dioxooxan-3-ylidene]pentanamide |
|---|---|
| PubChem CID | 165368397 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (5E)-5-hydroxy-N,N-dimethyl-5-[(6R)-6-methyl-2,4-dioxooxan-3-ylidene]pentanamide |
| SMILES | C[C@@H]1CC(=O)/C(=C(\O)CCCC(=O)N(C)C)C(=O)O1 |
| InChI | InChI=1S/C13H19NO5/c1-8-7-10(16)12(13(18)19-8)9(15)5-4-6-11(17)14(2)3/h8,15H,4-7H2,1-3H3/b12-9+/t8-/m1/s1 |
| InChIKey | PSTMQIOVDPXDIO-WLDSJTMESA-N |
| XLogP | 0.96 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|