C17H27NO5 — CID 165368401
(5E)-5-hydroxy-5-[(6R)-6-methyl-2,4-dioxooxan-3-ylidene]-N,N-di(propan-2-yl)pentanamide (PubChem CID 165368401) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is (5E)-5-hydroxy-5-[(6R)-6-methyl-2,4-dioxooxan-3-ylidene]-N,N-di(propan-2-yl)pentanamide.
| Compound Name | (5E)-5-hydroxy-5-[(6R)-6-methyl-2,4-dioxooxan-3-ylidene]-N,N-di(propan-2-yl)pentanamide |
|---|---|
| PubChem CID | 165368401 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (5E)-5-hydroxy-5-[(6R)-6-methyl-2,4-dioxooxan-3-ylidene]-N,N-di(propan-2-yl)pentanamide |
| SMILES | CC(C)N(C(=O)CCC/C(O)=C1/C(=O)C[C@@H](C)OC1=O)C(C)C |
| InChI | InChI=1S/C17H27NO5/c1-10(2)18(11(3)4)15(21)8-6-7-13(19)16-14(20)9-12(5)23-17(16)22/h10-12,19H,6-9H2,1-5H3/b16-13+/t12-/m1/s1 |
| InChIKey | XTLUHODGHKOFKY-SIOXIVGBSA-N |
| XLogP | 2.52 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|