C36H48O6Si — CID 11215597
(3S,4S,6S)-6-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]-3-hydroxy-3-[(1S)-1-hydroxypropyl]-4-phenylmethoxyoxan-2-one (PubChem CID 11215597) has the molecular formula C36H48O6Si and a molecular weight of 604.86 g/mol. Its IUPAC name is (3S,4S,6S)-6-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]-3-hydroxy-3-[(1S)-1-hydroxypropyl]-4-phenylmethoxyoxan-2-one.
| Compound Name | (3S,4S,6S)-6-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]-3-hydroxy-3-[(1S)-1-hydroxypropyl]-4-phenylmethoxyoxan-2-one |
|---|---|
| PubChem CID | 11215597 |
| Molecular Formula | C36H48O6Si |
| Molecular Weight | 604.86 g/mol |
| Exact Mass | 604.32 |
| IUPAC Name | (3S,4S,6S)-6-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]-3-hydroxy-3-[(1S)-1-hydroxypropyl]-4-phenylmethoxyoxan-2-one |
| SMILES | CCC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1C[C@H](OCc2ccccc2)[C@@](O)([C@@H](O)CC)C(=O)O1 |
| InChI | InChI=1S/C36H48O6Si/c1-6-17-28(26-41-43(35(3,4)5,29-20-13-9-14-21-29)30-22-15-10-16-23-30)31-24-33(40-25-27-18-11-8-12-19-27)36(39,32(37)7-2)34(38)42-31/h8-16,18-23,28,31-33,37,39H,6-7,17,24-26H2,1-5H3/t28-,31-,32-,33-,36-/m0/s1 |
| InChIKey | NOARYRASPZEHMH-RAVRDVATSA-N |
| XLogP | 5.38 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.86 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|