C37H44O7Si — CID 10077716
(1R)-1-[(2S,3R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-3,4-bis(phenylmethoxy)oxolan-2-yl]ethane-1,2-diol (PubChem CID 10077716) has the molecular formula C37H44O7Si and a molecular weight of 628.84 g/mol. Its IUPAC name is (1R)-1-[(2S,3R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-3,4-bis(phenylmethoxy)oxolan-2-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(2S,3R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-3,4-bis(phenylmethoxy)oxolan-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 10077716 |
| Molecular Formula | C37H44O7Si |
| Molecular Weight | 628.84 g/mol |
| Exact Mass | 628.29 |
| IUPAC Name | (1R)-1-[(2S,3R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-3,4-bis(phenylmethoxy)oxolan-2-yl]ethane-1,2-diol |
| SMILES | CC(C)(C)[Si](OC[C@@]1([C@H](O)CO)OC(O)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H44O7Si/c1-36(2,3)45(30-20-12-6-13-21-30,31-22-14-7-15-23-31)43-27-37(32(39)24-38)34(42-26-29-18-10-5-11-19-29)33(35(40)44-37)41-25-28-16-8-4-9-17-28/h4-23,32-35,38-40H,24-27H2,1-3H3/t32-,33-,34-,35?,37+/m1/s1 |
| InChIKey | WULCLPCMRBMOLY-QDVFSRRFSA-N |
| XLogP | 4.17 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.84 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|