C23H28O6 — CID 11741715
(1R)-1-[(2S,3R,4R)-5-hydroxy-3,4-bis(phenylmethoxy)-2-prop-2-enyloxolan-2-yl]ethane-1,2-diol (PubChem CID 11741715) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is (1R)-1-[(2S,3R,4R)-5-hydroxy-3,4-bis(phenylmethoxy)-2-prop-2-enyloxolan-2-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(2S,3R,4R)-5-hydroxy-3,4-bis(phenylmethoxy)-2-prop-2-enyloxolan-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 11741715 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (1R)-1-[(2S,3R,4R)-5-hydroxy-3,4-bis(phenylmethoxy)-2-prop-2-enyloxolan-2-yl]ethane-1,2-diol |
| SMILES | C=CC[C@@]1([C@H](O)CO)OC(O)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H28O6/c1-2-13-23(19(25)14-24)21(28-16-18-11-7-4-8-12-18)20(22(26)29-23)27-15-17-9-5-3-6-10-17/h2-12,19-22,24-26H,1,13-16H2/t19-,20-,21-,22?,23+/m1/s1 |
| InChIKey | UZKYRSSDEJLBMW-WGAPZLIBSA-N |
| XLogP | 2.17 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|