C33H38O5 — CID 102423574
(2S,3S,4S,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3-bis(prop-2-enyl)oxan-3-ol (PubChem CID 102423574) has the molecular formula C33H38O5 and a molecular weight of 514.66 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3-bis(prop-2-enyl)oxan-3-ol.
| Compound Name | (2S,3S,4S,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3-bis(prop-2-enyl)oxan-3-ol |
|---|---|
| PubChem CID | 102423574 |
| Molecular Formula | C33H38O5 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | (2S,3S,4S,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3-bis(prop-2-enyl)oxan-3-ol |
| SMILES | C=CC[C@@H]1O[C@H](COCc2ccccc2)C(OCc2ccccc2)[C@H](OCc2ccccc2)[C@]1(O)CC=C |
| InChI | InChI=1S/C33H38O5/c1-3-14-30-33(34,21-4-2)32(37-24-28-19-12-7-13-20-28)31(36-23-27-17-10-6-11-18-27)29(38-30)25-35-22-26-15-8-5-9-16-26/h3-13,15-20,29-32,34H,1-2,14,21-25H2/t29-,30+,31?,32+,33+/m1/s1 |
| InChIKey | MNWVUIIWDIAOPF-BNYUHHSCSA-N |
| XLogP | 6.02 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|