C33H42O7Si — CID 59483090
1-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(methoxymethoxy)-7-(phenylmethoxymethoxy)-2-oxabicyclo[2.2.1]heptan-3-ol (PubChem CID 59483090) has the molecular formula C33H42O7Si and a molecular weight of 578.78 g/mol. Its IUPAC name is 1-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(methoxymethoxy)-7-(phenylmethoxymethoxy)-2-oxabicyclo[2.2.1]heptan-3-ol.
| Compound Name | 1-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(methoxymethoxy)-7-(phenylmethoxymethoxy)-2-oxabicyclo[2.2.1]heptan-3-ol |
|---|---|
| PubChem CID | 59483090 |
| Molecular Formula | C33H42O7Si |
| Molecular Weight | 578.78 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | 1-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(methoxymethoxy)-7-(phenylmethoxymethoxy)-2-oxabicyclo[2.2.1]heptan-3-ol |
| SMILES | COCOC1CC2C(O)OC1(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C2OCOCc1ccccc1 |
| InChI | InChI=1S/C33H42O7Si/c1-32(2,3)41(26-16-10-6-11-17-26,27-18-12-7-13-19-27)39-22-33-29(37-23-35-4)20-28(31(34)40-33)30(33)38-24-36-21-25-14-8-5-9-15-25/h5-19,28-31,34H,20-24H2,1-4H3 |
| InChIKey | ONYJTKYUWDHFJV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.78 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|