C28H37NO6Si — CID 24767240
2-[(3aS,4S,6S,6aR)-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-hydroxy-4-(methoxymethoxy)-3-oxo-1,2,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-6-yl]acetaldehyde (PubChem CID 24767240) has the molecular formula C28H37NO6Si and a molecular weight of 511.69 g/mol. Its IUPAC name is 2-[(3aS,4S,6S,6aR)-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-hydroxy-4-(methoxymethoxy)-3-oxo-1,2,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-6-yl]acetaldehyde.
| Compound Name | 2-[(3aS,4S,6S,6aR)-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-hydroxy-4-(methoxymethoxy)-3-oxo-1,2,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-6-yl]acetaldehyde |
|---|---|
| PubChem CID | 24767240 |
| Molecular Formula | C28H37NO6Si |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 2-[(3aS,4S,6S,6aR)-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-hydroxy-4-(methoxymethoxy)-3-oxo-1,2,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-6-yl]acetaldehyde |
| SMILES | COCO[C@H]1C[C@@H](CC=O)[C@H]2C(O)NC(=O)[C@@]12CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H37NO6Si/c1-27(2,3)36(21-11-7-5-8-12-21,22-13-9-6-10-14-22)35-18-28-23(34-19-33-4)17-20(15-16-30)24(28)25(31)29-26(28)32/h5-14,16,20,23-25,31H,15,17-19H2,1-4H3,(H,29,32)/t20-,23+,24+,25?,28+/m1/s1 |
| InChIKey | ZADJZBHFDNHLEE-WLDZUGNLSA-N |
| XLogP | 2.21 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|